C22H19BrClN3O2S — CID 41177432
(8S)-8-(5-bromo-2-methoxyphenyl)-3-(3-chloro-4-methylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile (PubChem CID 41177432) has the molecular formula C22H19BrClN3O2S and a molecular weight of 504.84 g/mol. Its IUPAC name is (8S)-8-(5-bromo-2-methoxyphenyl)-3-(3-chloro-4-methylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile.
| Compound Name | (8S)-8-(5-bromo-2-methoxyphenyl)-3-(3-chloro-4-methylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
|---|---|
| PubChem CID | 41177432 |
| Molecular Formula | C22H19BrClN3O2S |
| Molecular Weight | 504.84 g/mol |
| Exact Mass | 503.01 |
| IUPAC Name | (8S)-8-(5-bromo-2-methoxyphenyl)-3-(3-chloro-4-methylphenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
| SMILES | COc1ccc(Br)cc1[C@@H]1CC(=O)N2CN(c3ccc(C)c(Cl)c3)CSC2=C1C#N |
| InChI | InChI=1S/C22H19BrClN3O2S/c1-13-3-5-15(8-19(13)24)26-11-27-21(28)9-16(18(10-25)22(27)30-12-26)17-7-14(23)4-6-20(17)29-2/h3-8,16H,9,11-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | FYFZPISPEVLUSF-INIZCTEOSA-N |
| XLogP | 5.64 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.84 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |