C29H27N3O6 — CID 4117943
N-[3-hydroxy-1-[4-(2-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-9,10-dioxoanthracene-2-carboxamide (PubChem CID 4117943) has the molecular formula C29H27N3O6 and a molecular weight of 513.55 g/mol. Its IUPAC name is N-[3-hydroxy-1-[4-(2-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-9,10-dioxoanthracene-2-carboxamide.
| Compound Name | N-[3-hydroxy-1-[4-(2-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-9,10-dioxoanthracene-2-carboxamide |
|---|---|
| PubChem CID | 4117943 |
| Molecular Formula | C29H27N3O6 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | N-[3-hydroxy-1-[4-(2-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-9,10-dioxoanthracene-2-carboxamide |
| SMILES | COc1ccccc1N1CCN(C(=O)C(CO)NC(=O)c2ccc3c(c2)C(=O)c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C29H27N3O6/c1-38-25-9-5-4-8-24(25)31-12-14-32(15-13-31)29(37)23(17-33)30-28(36)18-10-11-21-22(16-18)27(35)20-7-3-2-6-19(20)26(21)34/h2-11,16,23,33H,12-15,17H2,1H3,(H,30,36) |
| InChIKey | VQHCSVRIBUMIBC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|