C18H18N2O3S — CID 41187115
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-phenylsulfanylpyridine-3-carboxylate (PubChem CID 41187115) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-phenylsulfanylpyridine-3-carboxylate.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-phenylsulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 41187115 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-phenylsulfanylpyridine-3-carboxylate |
| SMILES | C[C@H](OC(=O)c1cccnc1Sc1ccccc1)C(=O)NC1CC1 |
| InChI | InChI=1S/C18H18N2O3S/c1-12(16(21)20-13-9-10-13)23-18(22)15-8-5-11-19-17(15)24-14-6-3-2-4-7-14/h2-8,11-13H,9-10H2,1H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | DLKAHYLZSXJZCO-LBPRGKRZSA-N |
| XLogP | 3.06 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |