C13H16N2O3S — CID 8765308
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-methylsulfanylpyridine-3-carboxylate (PubChem CID 8765308) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-methylsulfanylpyridine-3-carboxylate.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-methylsulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 8765308 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-methylsulfanylpyridine-3-carboxylate |
| SMILES | CSc1ncccc1C(=O)O[C@@H](C)C(=O)NC1CC1 |
| InChI | InChI=1S/C13H16N2O3S/c1-8(11(16)15-9-5-6-9)18-13(17)10-4-3-7-14-12(10)19-2/h3-4,7-9H,5-6H2,1-2H3,(H,15,16)/t8-/m0/s1 |
| InChIKey | QJHVBZGXRSFUFB-QMMMGPOBSA-N |
| XLogP | 1.63 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |