C22H23FN4O2S — CID 41190619
(2S)-2-[1-benzyl-5-(4-fluorophenyl)imidazol-2-yl]sulfanyl-N-carbamoyl-3-methylbutanamide (PubChem CID 41190619) has the molecular formula C22H23FN4O2S and a molecular weight of 426.52 g/mol. Its IUPAC name is (2S)-2-[1-benzyl-5-(4-fluorophenyl)imidazol-2-yl]sulfanyl-N-carbamoyl-3-methylbutanamide.
| Compound Name | (2S)-2-[1-benzyl-5-(4-fluorophenyl)imidazol-2-yl]sulfanyl-N-carbamoyl-3-methylbutanamide |
|---|---|
| PubChem CID | 41190619 |
| Molecular Formula | C22H23FN4O2S |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (2S)-2-[1-benzyl-5-(4-fluorophenyl)imidazol-2-yl]sulfanyl-N-carbamoyl-3-methylbutanamide |
| SMILES | CC(C)[C@H](Sc1ncc(-c2ccc(F)cc2)n1Cc1ccccc1)C(=O)NC(N)=O |
| InChI | InChI=1S/C22H23FN4O2S/c1-14(2)19(20(28)26-21(24)29)30-22-25-12-18(16-8-10-17(23)11-9-16)27(22)13-15-6-4-3-5-7-15/h3-12,14,19H,13H2,1-2H3,(H3,24,26,28,29)/t19-/m0/s1 |
| InChIKey | PPGDJQRPIKMBJS-IBGZPJMESA-N |
| XLogP | 4.05 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |