C26H26N4O4S — CID 41190663
N-[(1R)-1-(1H-benzimidazol-2-yl)-2-phenylethyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 41190663) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is N-[(1R)-1-(1H-benzimidazol-2-yl)-2-phenylethyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[(1R)-1-(1H-benzimidazol-2-yl)-2-phenylethyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 41190663 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-[(1R)-1-(1H-benzimidazol-2-yl)-2-phenylethyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(N[C@H](Cc1ccccc1)c1nc2ccccc2[nH]1)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C26H26N4O4S/c31-26(20-9-6-10-21(18-20)35(32,33)30-13-15-34-16-14-30)29-24(17-19-7-2-1-3-8-19)25-27-22-11-4-5-12-23(22)28-25/h1-12,18,24H,13-17H2,(H,27,28)(H,29,31)/t24-/m1/s1 |
| InChIKey | DJYAVSGXKCXFIK-XMMPIXPASA-N |
| XLogP | 3.30 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |