C15H11N4O3S+ — CID 4119109
2-[(6-nitro-1H-benzimidazol-3-ium-2-yl)methylsulfanyl]-1,3-benzoxazole (PubChem CID 4119109) has the molecular formula C15H11N4O3S+ and a molecular weight of 327.35 g/mol. Its IUPAC name is 2-[(6-nitro-1H-benzimidazol-3-ium-2-yl)methylsulfanyl]-1,3-benzoxazole.
| Compound Name | 2-[(6-nitro-1H-benzimidazol-3-ium-2-yl)methylsulfanyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 4119109 |
| Molecular Formula | C15H11N4O3S+ |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 2-[(6-nitro-1H-benzimidazol-3-ium-2-yl)methylsulfanyl]-1,3-benzoxazole |
| SMILES | O=[N+]([O-])c1ccc2[nH+]c(CSc3nc4ccccc4o3)[nH]c2c1 |
| InChI | InChI=1S/C15H10N4O3S/c20-19(21)9-5-6-10-12(7-9)17-14(16-10)8-23-15-18-11-3-1-2-4-13(11)22-15/h1-7H,8H2,(H,16,17)/p+1 |
| InChIKey | AKYRFPVYJQICLN-UHFFFAOYSA-O |
| XLogP | 3.32 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|