C24H33N3O4S — CID 41193840
N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]acetamide (PubChem CID 41193840) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]acetamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]acetamide |
|---|---|
| PubChem CID | 41193840 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]acetamide |
| SMILES | COc1ccc([C@H]2CCCCCN2CC(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2C)cc1 |
| InChI | InChI=1S/C24H33N3O4S/c1-18-9-14-21(32(29,30)26(2)3)16-22(18)25-24(28)17-27-15-7-5-6-8-23(27)19-10-12-20(31-4)13-11-19/h9-14,16,23H,5-8,15,17H2,1-4H3,(H,25,28)/t23-/m1/s1 |
| InChIKey | XBMDIOGDVAWGEG-HSZRJFAPSA-N |
| XLogP | 3.81 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |