C20H25N3O3 — CID 41194124
N-(3-ethylpent-1-yn-3-yl)-2-[(4R)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 41194124) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(3-ethylpent-1-yn-3-yl)-2-[(4R)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(3-ethylpent-1-yn-3-yl)-2-[(4R)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 41194124 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-(3-ethylpent-1-yn-3-yl)-2-[(4R)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C#CC(CC)(CC)NC(=O)CN1C(=O)N[C@](C)(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C20H25N3O3/c1-6-20(7-2,8-3)21-16(24)13-23-17(25)19(5,22-18(23)26)15-11-9-14(4)10-12-15/h1,9-12H,7-8,13H2,2-5H3,(H,21,24)(H,22,26)/t19-/m1/s1 |
| InChIKey | XBPHJIJNBYYPTO-LJQANCHMSA-N |
| XLogP | 2.07 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|