C25H31N3O5S — CID 41197560
(3S)-N-[(6S)-3-carbamoyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 41197560) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is (3S)-N-[(6S)-3-carbamoyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(6S)-3-carbamoyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 41197560 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (3S)-N-[(6S)-3-carbamoyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(CCN2C[C@@H](C(=O)Nc3sc4c(c3C(N)=O)CC[C@H](C)C4)CC2=O)cc1OC |
| InChI | InChI=1S/C25H31N3O5S/c1-14-4-6-17-20(10-14)34-25(22(17)23(26)30)27-24(31)16-12-21(29)28(13-16)9-8-15-5-7-18(32-2)19(11-15)33-3/h5,7,11,14,16H,4,6,8-10,12-13H2,1-3H3,(H2,26,30)(H,27,31)/t14-,16-/m0/s1 |
| InChIKey | XYJIEZXWFXACEF-HOCLYGCPSA-N |
| XLogP | 3.02 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |