C19H27NO3S — CID 4119952
N-[2-(cyclohexen-1-yl)ethyl]-3-[(4-methylphenyl)methylsulfonyl]propanamide (PubChem CID 4119952) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-[(4-methylphenyl)methylsulfonyl]propanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[(4-methylphenyl)methylsulfonyl]propanamide |
|---|---|
| PubChem CID | 4119952 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[(4-methylphenyl)methylsulfonyl]propanamide |
| SMILES | Cc1ccc(CS(=O)(=O)CCC(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C19H27NO3S/c1-16-7-9-18(10-8-16)15-24(22,23)14-12-19(21)20-13-11-17-5-3-2-4-6-17/h5,7-10H,2-4,6,11-15H2,1H3,(H,20,21) |
| InChIKey | ZJRRTGRJQISVOP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|