C27H35N2O3+ — CID 4120455
3-[3-[(2,5-dimethylphenyl)-hydroxymethylidene]-2-(4-methylphenyl)-4,5-dioxopyrrolidin-1-yl]propyl-diethylazanium (PubChem CID 4120455) has the molecular formula C27H35N2O3+ and a molecular weight of 435.59 g/mol. Its IUPAC name is 3-[3-[(2,5-dimethylphenyl)-hydroxymethylidene]-2-(4-methylphenyl)-4,5-dioxopyrrolidin-1-yl]propyl-diethylazanium.
| Compound Name | 3-[3-[(2,5-dimethylphenyl)-hydroxymethylidene]-2-(4-methylphenyl)-4,5-dioxopyrrolidin-1-yl]propyl-diethylazanium |
|---|---|
| PubChem CID | 4120455 |
| Molecular Formula | C27H35N2O3+ |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 3-[3-[(2,5-dimethylphenyl)-hydroxymethylidene]-2-(4-methylphenyl)-4,5-dioxopyrrolidin-1-yl]propyl-diethylazanium |
| SMILES | CC[NH+](CC)CCCN1C(=O)C(=O)C(=C(O)c2cc(C)ccc2C)C1c1ccc(C)cc1 |
| InChI | InChI=1S/C27H34N2O3/c1-6-28(7-2)15-8-16-29-24(21-13-10-18(3)11-14-21)23(26(31)27(29)32)25(30)22-17-19(4)9-12-20(22)5/h9-14,17,24,30H,6-8,15-16H2,1-5H3/p+1 |
| InChIKey | ITVWAWFZYYLFFC-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|