C26H31IN2O3 — CID 6267545
(4E)-1-[3-(diethylamino)propyl]-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(4-iodophenyl)pyrrolidine-2,3-dione (PubChem CID 6267545) has the molecular formula C26H31IN2O3 and a molecular weight of 546.45 g/mol. Its IUPAC name is (4E)-1-[3-(diethylamino)propyl]-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(4-iodophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-[3-(diethylamino)propyl]-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(4-iodophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6267545 |
| Molecular Formula | C26H31IN2O3 |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | (4E)-1-[3-(diethylamino)propyl]-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(4-iodophenyl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)CCCN1C(=O)C(=O)/C(=C(/O)c2cc(C)ccc2C)C1c1ccc(I)cc1 |
| InChI | InChI=1S/C26H31IN2O3/c1-5-28(6-2)14-7-15-29-23(19-10-12-20(27)13-11-19)22(25(31)26(29)32)24(30)21-16-17(3)8-9-18(21)4/h8-13,16,23,30H,5-7,14-15H2,1-4H3/b24-22+ |
| InChIKey | IBOUVWBQLAAXPY-ZNTNEXAZSA-N |
| XLogP | 5.06 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|