C31H25NO6 — CID 4121463
1-(furan-2-ylmethyl)-4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 4121463) has the molecular formula C31H25NO6 and a molecular weight of 507.54 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(furan-2-ylmethyl)-4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4121463 |
| Molecular Formula | C31H25NO6 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 1-(furan-2-ylmethyl)-4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | C=CCOc1ccc(C(O)=C2C(=O)C(=O)N(Cc3ccco3)C2c2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C31H25NO6/c1-2-17-36-23-15-13-21(14-16-23)29(33)27-28(32(31(35)30(27)34)20-26-12-7-18-37-26)22-8-6-11-25(19-22)38-24-9-4-3-5-10-24/h2-16,18-19,28,33H,1,17,20H2 |
| InChIKey | DKTWFILAIJLCMX-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|