About [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate (PubChem CID 41228226) has the molecular formula C20H17N3O4S
and a molecular weight of 395.44 g/mol. Its IUPAC name is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate.
Molecular Properties
| Compound Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate |
| PubChem CID | 41228226 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate |
| SMILES | N#CCCN(CCC#N)C(=O)COC(=O)c1cc2c(s1)-c1ccccc1OC2 |
| InChI | InChI=1S/C20H17N3O4S/c21-7-3-9-23(10-4-8-22)18(24)13-27-20(25)17-11-14-12-26-16-6-2-1-5-15(16)19(14)28-17/h1-2,5-6,11H,3-4,9-10,12-13H2 |
| InChIKey | NDVBYJGVPZCNQJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 103.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate?
The IUPAC name of [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate (CID 41228226) is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate.
What is the SMILES notation for [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate?
The canonical SMILES for [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate is N#CCCN(CCC#N)C(=O)COC(=O)c1cc2c(s1)-c1ccccc1OC2.
What is the InChIKey of [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate?
The InChIKey is NDVBYJGVPZCNQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O4S/c21-7-3-9-23(10-4-8-22)18(24)13-27-20(25)17-11-14-12-26-16-6-2-1-5-15(16)19(14)28-17/h1-2,5-6,11H,3-4,9-10,12-13H2.
What are the key properties of [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate?
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate has a molecular weight of 395.44 g/mol, XLogP of 3.12, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate is sourced from PubChem (CID 41228226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).