C18H16FN3O2S — CID 41237321
1-[2-[2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]ethanone (PubChem CID 41237321) has the molecular formula C18H16FN3O2S and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-[2-[2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]ethanone.
| Compound Name | 1-[2-[2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 41237321 |
| Molecular Formula | C18H16FN3O2S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-[2-[2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1OCCSc1n[nH]c(-c2ccccc2F)n1 |
| InChI | InChI=1S/C18H16FN3O2S/c1-12(23)13-6-3-5-9-16(13)24-10-11-25-18-20-17(21-22-18)14-7-2-4-8-15(14)19/h2-9H,10-11H2,1H3,(H,20,21,22) |
| InChIKey | NJKVYSXFQUAOGG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|