C16H13ClFN3OS — CID 30682362
3-[2-(3-chlorophenoxy)ethylsulfanyl]-5-(2-fluorophenyl)-1H-1,2,4-triazole (PubChem CID 30682362) has the molecular formula C16H13ClFN3OS and a molecular weight of 349.82 g/mol. Its IUPAC name is 3-[2-(3-chlorophenoxy)ethylsulfanyl]-5-(2-fluorophenyl)-1H-1,2,4-triazole.
| Compound Name | 3-[2-(3-chlorophenoxy)ethylsulfanyl]-5-(2-fluorophenyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 30682362 |
| Molecular Formula | C16H13ClFN3OS |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 3-[2-(3-chlorophenoxy)ethylsulfanyl]-5-(2-fluorophenyl)-1H-1,2,4-triazole |
| SMILES | Fc1ccccc1-c1nc(SCCOc2cccc(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C16H13ClFN3OS/c17-11-4-3-5-12(10-11)22-8-9-23-16-19-15(20-21-16)13-6-1-2-7-14(13)18/h1-7,10H,8-9H2,(H,19,20,21) |
| InChIKey | HCBRUNWDAKXBHZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|