C6H2BrCl3 — CID 4124400
5-bromo-1,2,3-trichlorobenzene (PubChem CID 4124400) has the molecular formula C6H2BrCl3 and a molecular weight of 260.35 g/mol. Its IUPAC name is 5-bromo-1,2,3-trichlorobenzene.
| Compound Name | 5-bromo-1,2,3-trichlorobenzene |
|---|---|
| PubChem CID | 4124400 |
| Molecular Formula | C6H2BrCl3 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 257.84 |
| IUPAC Name | 5-bromo-1,2,3-trichlorobenzene |
| SMILES | Clc1cc(Br)cc(Cl)c1Cl |
| InChI | InChI=1S/C6H2BrCl3/c7-3-1-4(8)6(10)5(9)2-3/h1-2H |
| InChIKey | VZUMVBQMJFFYRM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|