C6HBrCl4 — CID 517976
1-bromo-2,3,4,5-tetrachlorobenzene (PubChem CID 517976) has the molecular formula C6HBrCl4 and a molecular weight of 294.79 g/mol. Its IUPAC name is 1-bromo-2,3,4,5-tetrachlorobenzene.
| Compound Name | 1-bromo-2,3,4,5-tetrachlorobenzene |
|---|---|
| PubChem CID | 517976 |
| Molecular Formula | C6HBrCl4 |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 291.80 |
| IUPAC Name | 1-bromo-2,3,4,5-tetrachlorobenzene |
| SMILES | Clc1cc(Br)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6HBrCl4/c7-2-1-3(8)5(10)6(11)4(2)9/h1H |
| InChIKey | NEPMWYGBQGFJHN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|