C6BrCl5 — CID 3014710
1-bromo-2,3,4,5,6-pentachlorobenzene (PubChem CID 3014710) has the molecular formula C6BrCl5 and a molecular weight of 329.24 g/mol. Its IUPAC name is 1-bromo-2,3,4,5,6-pentachlorobenzene.
| Compound Name | 1-bromo-2,3,4,5,6-pentachlorobenzene |
|---|---|
| PubChem CID | 3014710 |
| Molecular Formula | C6BrCl5 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 325.76 |
| IUPAC Name | 1-bromo-2,3,4,5,6-pentachlorobenzene |
| SMILES | Clc1c(Cl)c(Cl)c(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C6BrCl5/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | TZHWGHMDCFAJPT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|