C23H21N5O3S — CID 41259195
1-phenyl-3-pyridin-3-yl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]pyrazole-4-carboxamide (PubChem CID 41259195) has the molecular formula C23H21N5O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is 1-phenyl-3-pyridin-3-yl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]pyrazole-4-carboxamide.
| Compound Name | 1-phenyl-3-pyridin-3-yl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 41259195 |
| Molecular Formula | C23H21N5O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 1-phenyl-3-pyridin-3-yl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]pyrazole-4-carboxamide |
| SMILES | C[C@H](NC(=O)c1cn(-c2ccccc2)nc1-c1cccnc1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C23H21N5O3S/c1-16(17-9-11-20(12-10-17)32(24,30)31)26-23(29)21-15-28(19-7-3-2-4-8-19)27-22(21)18-6-5-13-25-14-18/h2-16H,1H3,(H,26,29)(H2,24,30,31)/t16-/m0/s1 |
| InChIKey | KRXOFGBJTGWFBZ-INIZCTEOSA-N |
| XLogP | 3.07 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |