C25H25FN2O4S — CID 41259338
N'-[(2S)-2-(4-ethoxyphenoxy)propanoyl]-2-[(2-fluorophenyl)methylsulfanyl]benzohydrazide (PubChem CID 41259338) has the molecular formula C25H25FN2O4S and a molecular weight of 468.55 g/mol. Its IUPAC name is N'-[(2S)-2-(4-ethoxyphenoxy)propanoyl]-2-[(2-fluorophenyl)methylsulfanyl]benzohydrazide.
| Compound Name | N'-[(2S)-2-(4-ethoxyphenoxy)propanoyl]-2-[(2-fluorophenyl)methylsulfanyl]benzohydrazide |
|---|---|
| PubChem CID | 41259338 |
| Molecular Formula | C25H25FN2O4S |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | N'-[(2S)-2-(4-ethoxyphenoxy)propanoyl]-2-[(2-fluorophenyl)methylsulfanyl]benzohydrazide |
| SMILES | CCOc1ccc(O[C@@H](C)C(=O)NNC(=O)c2ccccc2SCc2ccccc2F)cc1 |
| InChI | InChI=1S/C25H25FN2O4S/c1-3-31-19-12-14-20(15-13-19)32-17(2)24(29)27-28-25(30)21-9-5-7-11-23(21)33-16-18-8-4-6-10-22(18)26/h4-15,17H,3,16H2,1-2H3,(H,27,29)(H,28,30)/t17-/m0/s1 |
| InChIKey | OUEZHDQEXUIZGY-KRWDZBQOSA-N |
| XLogP | 4.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|