C21H23N5O4S2 — CID 41262484
N-[2-(4-nitroanilino)ethyl]-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide (PubChem CID 41262484) has the molecular formula C21H23N5O4S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-[2-(4-nitroanilino)ethyl]-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide.
| Compound Name | N-[2-(4-nitroanilino)ethyl]-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 41262484 |
| Molecular Formula | C21H23N5O4S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | N-[2-(4-nitroanilino)ethyl]-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1nc2sc3c(c2c(=O)[nH]1)CCCC3)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H23N5O4S2/c27-18(23-10-9-22-13-5-7-14(8-6-13)26(29)30)12-31-11-17-24-20(28)19-15-3-1-2-4-16(15)32-21(19)25-17/h5-8,22H,1-4,9-12H2,(H,23,27)(H,24,25,28) |
| InChIKey | XNNGFJCVAMFAGE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|