C25H31N3O3 — CID 41278258
2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]-N-[3-(N-ethylanilino)propyl]acetamide (PubChem CID 41278258) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]-N-[3-(N-ethylanilino)propyl]acetamide.
| Compound Name | 2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]-N-[3-(N-ethylanilino)propyl]acetamide |
|---|---|
| PubChem CID | 41278258 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]-N-[3-(N-ethylanilino)propyl]acetamide |
| SMILES | CCN(CCCNC(=O)Cc1ccc(OCc2c(C)noc2C)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H31N3O3/c1-4-28(22-9-6-5-7-10-22)16-8-15-26-25(29)17-21-11-13-23(14-12-21)30-18-24-19(2)27-31-20(24)3/h5-7,9-14H,4,8,15-18H2,1-3H3,(H,26,29) |
| InChIKey | UJCDQKYDJNGOIT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|