C21H29N3OS — CID 41289534
(2R)-2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-(cyclohexylmethyl)propanamide (PubChem CID 41289534) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is (2R)-2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-(cyclohexylmethyl)propanamide.
| Compound Name | (2R)-2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-(cyclohexylmethyl)propanamide |
|---|---|
| PubChem CID | 41289534 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | (2R)-2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-(cyclohexylmethyl)propanamide |
| SMILES | Cc1[nH]c(S[C@H](C)C(=O)NCC2CCCCC2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C21H29N3OS/c1-15-19(13-17-9-5-3-6-10-17)24-21(23-15)26-16(2)20(25)22-14-18-11-7-4-8-12-18/h3,5-6,9-10,16,18H,4,7-8,11-14H2,1-2H3,(H,22,25)(H,23,24)/t16-/m1/s1 |
| InChIKey | QVZPNJDEGJNWEK-MRXNPFEDSA-N |
| XLogP | 4.49 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |