C22H25N3OS — CID 7250744
(2S)-2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-(4-ethylphenyl)propanamide (PubChem CID 7250744) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is (2S)-2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-(4-ethylphenyl)propanamide.
| Compound Name | (2S)-2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-(4-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 7250744 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (2S)-2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-(4-ethylphenyl)propanamide |
| SMILES | CCc1ccc(NC(=O)[C@H](C)Sc2nc(Cc3ccccc3)c(C)[nH]2)cc1 |
| InChI | InChI=1S/C22H25N3OS/c1-4-17-10-12-19(13-11-17)24-21(26)16(3)27-22-23-15(2)20(25-22)14-18-8-6-5-7-9-18/h5-13,16H,4,14H2,1-3H3,(H,23,25)(H,24,26)/t16-/m0/s1 |
| InChIKey | XDCHYCJSBMIDFC-INIZCTEOSA-N |
| XLogP | 4.99 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |