C19H30N4O7 — CID 41295179
[2-(3-ethoxypropylcarbamoylamino)-2-oxoethyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 41295179) has the molecular formula C19H30N4O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is [2-(3-ethoxypropylcarbamoylamino)-2-oxoethyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | [2-(3-ethoxypropylcarbamoylamino)-2-oxoethyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 41295179 |
| Molecular Formula | C19H30N4O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | [2-(3-ethoxypropylcarbamoylamino)-2-oxoethyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | CCOCCCNC(=O)NC(=O)COC(=O)CN1C(=O)N[C@]2(CCCC[C@H]2C)C1=O |
| InChI | InChI=1S/C19H30N4O7/c1-3-29-10-6-9-20-17(27)21-14(24)12-30-15(25)11-23-16(26)19(22-18(23)28)8-5-4-7-13(19)2/h13H,3-12H2,1-2H3,(H,22,28)(H2,20,21,24,27)/t13-,19+/m1/s1 |
| InChIKey | STPGRSKXBZMCAU-YJYMSZOUSA-N |
| XLogP | 0.28 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|