C19H31N3O6 — CID 9072583
[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 9072583) has the molecular formula C19H31N3O6 and a molecular weight of 397.47 g/mol. Its IUPAC name is [2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | [2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 9072583 |
| Molecular Formula | C19H31N3O6 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | [2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | CC(C)OCCCNC(=O)COC(=O)CN1C(=O)N[C@]2(CCCC[C@H]2C)C1=O |
| InChI | InChI=1S/C19H31N3O6/c1-13(2)27-10-6-9-20-15(23)12-28-16(24)11-22-17(25)19(21-18(22)26)8-5-4-7-14(19)3/h13-14H,4-12H2,1-3H3,(H,20,23)(H,21,26)/t14-,19+/m1/s1 |
| InChIKey | XWPKKBCJIWOIIA-KUHUBIRLSA-N |
| XLogP | 0.96 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|