C22H19Cl2NO4 — CID 41300058
(5R)-4-[(3-chloro-4-ethoxyphenyl)-hydroxymethylidene]-5-(3-chlorophenyl)-1-prop-2-enylpyrrolidine-2,3-dione (PubChem CID 41300058) has the molecular formula C22H19Cl2NO4 and a molecular weight of 432.30 g/mol. Its IUPAC name is (5R)-4-[(3-chloro-4-ethoxyphenyl)-hydroxymethylidene]-5-(3-chlorophenyl)-1-prop-2-enylpyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[(3-chloro-4-ethoxyphenyl)-hydroxymethylidene]-5-(3-chlorophenyl)-1-prop-2-enylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41300058 |
| Molecular Formula | C22H19Cl2NO4 |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | (5R)-4-[(3-chloro-4-ethoxyphenyl)-hydroxymethylidene]-5-(3-chlorophenyl)-1-prop-2-enylpyrrolidine-2,3-dione |
| SMILES | C=CCN1C(=O)C(=O)C(=C(O)c2ccc(OCC)c(Cl)c2)[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H19Cl2NO4/c1-3-10-25-19(13-6-5-7-15(23)11-13)18(21(27)22(25)28)20(26)14-8-9-17(29-4-2)16(24)12-14/h3,5-9,11-12,19,26H,1,4,10H2,2H3/t19-/m1/s1 |
| InChIKey | SBBWTVPHTMORLE-LJQANCHMSA-N |
| XLogP | 5.00 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|