C26H24N2O7 — CID 41301905
(2R,3S)-2,3-bis[(4-methylbenzoyl)oxy]-4-oxo-4-(pyridin-2-ylmethylamino)butanoic acid (PubChem CID 41301905) has the molecular formula C26H24N2O7 and a molecular weight of 476.49 g/mol. Its IUPAC name is (2R,3S)-2,3-bis[(4-methylbenzoyl)oxy]-4-oxo-4-(pyridin-2-ylmethylamino)butanoic acid.
| Compound Name | (2R,3S)-2,3-bis[(4-methylbenzoyl)oxy]-4-oxo-4-(pyridin-2-ylmethylamino)butanoic acid |
|---|---|
| PubChem CID | 41301905 |
| Molecular Formula | C26H24N2O7 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | (2R,3S)-2,3-bis[(4-methylbenzoyl)oxy]-4-oxo-4-(pyridin-2-ylmethylamino)butanoic acid |
| SMILES | Cc1ccc(C(=O)O[C@H](C(=O)NCc2ccccn2)[C@@H](OC(=O)c2ccc(C)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C26H24N2O7/c1-16-6-10-18(11-7-16)25(32)34-21(23(29)28-15-20-5-3-4-14-27-20)22(24(30)31)35-26(33)19-12-8-17(2)9-13-19/h3-14,21-22H,15H2,1-2H3,(H,28,29)(H,30,31)/t21-,22+/m0/s1 |
| InChIKey | FSQXFFWZISBWEX-FCHUYYIVSA-N |
| XLogP | 2.85 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |