C24H18Cl2N2O7 — CID 126386032
(2R,3R)-2,3-bis[(2-chlorobenzoyl)oxy]-4-oxo-4-(pyridin-2-ylmethylamino)butanoic acid (PubChem CID 126386032) has the molecular formula C24H18Cl2N2O7 and a molecular weight of 517.32 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(2-chlorobenzoyl)oxy]-4-oxo-4-(pyridin-2-ylmethylamino)butanoic acid.
| Compound Name | (2R,3R)-2,3-bis[(2-chlorobenzoyl)oxy]-4-oxo-4-(pyridin-2-ylmethylamino)butanoic acid |
|---|---|
| PubChem CID | 126386032 |
| Molecular Formula | C24H18Cl2N2O7 |
| Molecular Weight | 517.32 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | (2R,3R)-2,3-bis[(2-chlorobenzoyl)oxy]-4-oxo-4-(pyridin-2-ylmethylamino)butanoic acid |
| SMILES | O=C(O[C@@H](C(=O)O)[C@@H](OC(=O)c1ccccc1Cl)C(=O)NCc1ccccn1)c1ccccc1Cl |
| InChI | InChI=1S/C24H18Cl2N2O7/c25-17-10-3-1-8-15(17)23(32)34-19(21(29)28-13-14-7-5-6-12-27-14)20(22(30)31)35-24(33)16-9-2-4-11-18(16)26/h1-12,19-20H,13H2,(H,28,29)(H,30,31)/t19-,20-/m1/s1 |
| InChIKey | GZXMQWBHHNVOHF-WOJBJXKFSA-N |
| XLogP | 3.54 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |