C26H35N3O3 — CID 41307264
(2R,3R)-N-(2,4-dimorpholin-4-ylphenyl)-3-methyl-2-phenylpentanamide (PubChem CID 41307264) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is (2R,3R)-N-(2,4-dimorpholin-4-ylphenyl)-3-methyl-2-phenylpentanamide.
| Compound Name | (2R,3R)-N-(2,4-dimorpholin-4-ylphenyl)-3-methyl-2-phenylpentanamide |
|---|---|
| PubChem CID | 41307264 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | (2R,3R)-N-(2,4-dimorpholin-4-ylphenyl)-3-methyl-2-phenylpentanamide |
| SMILES | CC[C@@H](C)[C@@H](C(=O)Nc1ccc(N2CCOCC2)cc1N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C26H35N3O3/c1-3-20(2)25(21-7-5-4-6-8-21)26(30)27-23-10-9-22(28-11-15-31-16-12-28)19-24(23)29-13-17-32-18-14-29/h4-10,19-20,25H,3,11-18H2,1-2H3,(H,27,30)/t20-,25-/m1/s1 |
| InChIKey | BVZFTQQUJDUZPI-CJFMBICVSA-N |
| XLogP | 4.13 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |