C25H22Cl2N4O7S — CID 4131659
methyl 3-[[5-[(2,5-dichlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]carbamoyl]-5-nitrobenzoate (PubChem CID 4131659) has the molecular formula C25H22Cl2N4O7S and a molecular weight of 593.45 g/mol. Its IUPAC name is methyl 3-[[5-[(2,5-dichlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]carbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[[5-[(2,5-dichlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 4131659 |
| Molecular Formula | C25H22Cl2N4O7S |
| Molecular Weight | 593.45 g/mol |
| Exact Mass | 592.06 |
| IUPAC Name | methyl 3-[[5-[(2,5-dichlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]carbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)Nc2cc(S(=O)(=O)Nc3cc(Cl)ccc3Cl)ccc2N2CCCC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H22Cl2N4O7S/c1-38-25(33)16-10-15(11-18(12-16)31(34)35)24(32)28-22-14-19(5-7-23(22)30-8-2-3-9-30)39(36,37)29-21-13-17(26)4-6-20(21)27/h4-7,10-14,29H,2-3,8-9H2,1H3,(H,28,32) |
| InChIKey | GSORDHCIMWCTIN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|