C8H13N2O3+ — CID 4131758
3-morpholin-4-ium-4-ylpyrrolidine-2,5-dione (PubChem CID 4131758) has the molecular formula C8H13N2O3+ and a molecular weight of 185.20 g/mol. Its IUPAC name is 3-morpholin-4-ium-4-ylpyrrolidine-2,5-dione.
| Compound Name | 3-morpholin-4-ium-4-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4131758 |
| Molecular Formula | C8H13N2O3+ |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 3-morpholin-4-ium-4-ylpyrrolidine-2,5-dione |
| SMILES | O=C1CC([NH+]2CCOCC2)C(=O)N1 |
| InChI | InChI=1S/C8H12N2O3/c11-7-5-6(8(12)9-7)10-1-3-13-4-2-10/h6H,1-5H2,(H,9,11,12)/p+1 |
| InChIKey | UYDKOSYWGWXDRQ-UHFFFAOYSA-O |
| XLogP | -2.68 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|