C19H13NO2S — CID 4132232
3-(1,3-benzothiazol-2-yl)-8-prop-2-enylchromen-2-one (PubChem CID 4132232) has the molecular formula C19H13NO2S and a molecular weight of 319.39 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-8-prop-2-enylchromen-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-8-prop-2-enylchromen-2-one |
|---|---|
| PubChem CID | 4132232 |
| Molecular Formula | C19H13NO2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-8-prop-2-enylchromen-2-one |
| SMILES | C=CCc1cccc2cc(-c3nc4ccccc4s3)c(=O)oc12 |
| InChI | InChI=1S/C19H13NO2S/c1-2-6-12-7-5-8-13-11-14(19(21)22-17(12)13)18-20-15-9-3-4-10-16(15)23-18/h2-5,7-11H,1,6H2 |
| InChIKey | UPGLKGYQUFFWKD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|