C18H17ClN2O4 — CID 41323939
[(2S)-1-(2-acetylanilino)-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate (PubChem CID 41323939) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is [(2S)-1-(2-acetylanilino)-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate.
| Compound Name | [(2S)-1-(2-acetylanilino)-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 41323939 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | [(2S)-1-(2-acetylanilino)-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate |
| SMILES | CC(=O)c1ccccc1NC(=O)[C@H](C)OC(=O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C18H17ClN2O4/c1-10(22)13-5-3-4-6-16(13)21-17(23)11(2)25-18(24)12-7-8-14(19)15(20)9-12/h3-9,11H,20H2,1-2H3,(H,21,23)/t11-/m0/s1 |
| InChIKey | GFJKVOUBWNOHDF-NSHDSACASA-N |
| XLogP | 3.31 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|