C16H15Cl2NO4S — CID 41324012
N-(2,3-dichlorophenyl)-3-(4-methoxyphenyl)sulfonylpropanamide (PubChem CID 41324012) has the molecular formula C16H15Cl2NO4S and a molecular weight of 388.27 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-3-(4-methoxyphenyl)sulfonylpropanamide.
| Compound Name | N-(2,3-dichlorophenyl)-3-(4-methoxyphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 41324012 |
| Molecular Formula | C16H15Cl2NO4S |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | N-(2,3-dichlorophenyl)-3-(4-methoxyphenyl)sulfonylpropanamide |
| SMILES | COc1ccc(S(=O)(=O)CCC(=O)Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2NO4S/c1-23-11-5-7-12(8-6-11)24(21,22)10-9-15(20)19-14-4-2-3-13(17)16(14)18/h2-8H,9-10H2,1H3,(H,19,20) |
| InChIKey | WZEUCWOPLYGVBU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |