C18H17Cl2NO3 — CID 110298279
N-(2,3-dichlorophenyl)-5-(4-methoxyphenyl)-5-oxopentanamide (PubChem CID 110298279) has the molecular formula C18H17Cl2NO3 and a molecular weight of 366.24 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-5-(4-methoxyphenyl)-5-oxopentanamide.
| Compound Name | N-(2,3-dichlorophenyl)-5-(4-methoxyphenyl)-5-oxopentanamide |
|---|---|
| PubChem CID | 110298279 |
| Molecular Formula | C18H17Cl2NO3 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-(2,3-dichlorophenyl)-5-(4-methoxyphenyl)-5-oxopentanamide |
| SMILES | COc1ccc(C(=O)CCCC(=O)Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C18H17Cl2NO3/c1-24-13-10-8-12(9-11-13)16(22)6-3-7-17(23)21-15-5-2-4-14(19)18(15)20/h2,4-5,8-11H,3,6-7H2,1H3,(H,21,23) |
| InChIKey | UOIXZLNTIBREME-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |