C23H28N4O — CID 41337356
(2R)-N-(2-cyanophenyl)-2-[methyl-[(2-piperidin-1-ylphenyl)methyl]amino]propanamide (PubChem CID 41337356) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is (2R)-N-(2-cyanophenyl)-2-[methyl-[(2-piperidin-1-ylphenyl)methyl]amino]propanamide.
| Compound Name | (2R)-N-(2-cyanophenyl)-2-[methyl-[(2-piperidin-1-ylphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 41337356 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | (2R)-N-(2-cyanophenyl)-2-[methyl-[(2-piperidin-1-ylphenyl)methyl]amino]propanamide |
| SMILES | C[C@H](C(=O)Nc1ccccc1C#N)N(C)Cc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C23H28N4O/c1-18(23(28)25-21-12-6-4-10-19(21)16-24)26(2)17-20-11-5-7-13-22(20)27-14-8-3-9-15-27/h4-7,10-13,18H,3,8-9,14-15,17H2,1-2H3,(H,25,28)/t18-/m1/s1 |
| InChIKey | PQZUCVDMMIEZLJ-GOSISDBHSA-N |
| XLogP | 4.01 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |