C27H26N4O3 — CID 41339930
[(5S,7R)-5,7-bis(4-methoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-methylphenyl)methanone (PubChem CID 41339930) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is [(5S,7R)-5,7-bis(4-methoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-methylphenyl)methanone.
| Compound Name | [(5S,7R)-5,7-bis(4-methoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 41339930 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | [(5S,7R)-5,7-bis(4-methoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-methylphenyl)methanone |
| SMILES | COc1ccc([C@H]2C[C@@H](c3ccc(OC)cc3)N(C(=O)c3cccc(C)c3)c3ncnn32)cc1 |
| InChI | InChI=1S/C27H26N4O3/c1-18-5-4-6-21(15-18)26(32)30-24(19-7-11-22(33-2)12-8-19)16-25(31-27(30)28-17-29-31)20-9-13-23(34-3)14-10-20/h4-15,17,24-25H,16H2,1-3H3/t24-,25+/m0/s1 |
| InChIKey | RUCFHLMSFGCBSG-LOSJGSFVSA-N |
| XLogP | 4.98 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |