C26H23N5O5 — CID 41340028
[(5R,7R)-7-(2-methoxyphenyl)-5-(4-methoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-nitrophenyl)methanone (PubChem CID 41340028) has the molecular formula C26H23N5O5 and a molecular weight of 485.50 g/mol. Its IUPAC name is [(5R,7R)-7-(2-methoxyphenyl)-5-(4-methoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-nitrophenyl)methanone.
| Compound Name | [(5R,7R)-7-(2-methoxyphenyl)-5-(4-methoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 41340028 |
| Molecular Formula | C26H23N5O5 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | [(5R,7R)-7-(2-methoxyphenyl)-5-(4-methoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-nitrophenyl)methanone |
| SMILES | COc1ccc([C@H]2C[C@H](c3ccccc3OC)n3ncnc3N2C(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H23N5O5/c1-35-20-12-10-17(11-13-20)22-15-23(21-8-3-4-9-24(21)36-2)30-26(27-16-28-30)29(22)25(32)18-6-5-7-19(14-18)31(33)34/h3-14,16,22-23H,15H2,1-2H3/t22-,23-/m1/s1 |
| InChIKey | KYWMMYWKNSWQLU-DHIUTWEWSA-N |
| XLogP | 4.58 |
| TPSA | 112.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|