C24H18ClN5O3 — CID 41002598
[(5S,7S)-7-(2-chlorophenyl)-5-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-nitrophenyl)methanone (PubChem CID 41002598) has the molecular formula C24H18ClN5O3 and a molecular weight of 459.89 g/mol. Its IUPAC name is [(5S,7S)-7-(2-chlorophenyl)-5-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-nitrophenyl)methanone.
| Compound Name | [(5S,7S)-7-(2-chlorophenyl)-5-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 41002598 |
| Molecular Formula | C24H18ClN5O3 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | [(5S,7S)-7-(2-chlorophenyl)-5-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1c2ncnn2[C@H](c2ccccc2Cl)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H18ClN5O3/c25-20-12-5-4-11-19(20)22-14-21(16-7-2-1-3-8-16)28(24-26-15-27-29(22)24)23(31)17-9-6-10-18(13-17)30(32)33/h1-13,15,21-22H,14H2/t21-,22-/m0/s1 |
| InChIKey | FZYWEMXLWQDXTE-VXKWHMMOSA-N |
| XLogP | 5.22 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|