C24H19N5O3 — CID 41339555
[(5S,7S)-5,7-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(4-nitrophenyl)methanone (PubChem CID 41339555) has the molecular formula C24H19N5O3 and a molecular weight of 425.45 g/mol. Its IUPAC name is [(5S,7S)-5,7-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(4-nitrophenyl)methanone.
| Compound Name | [(5S,7S)-5,7-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 41339555 |
| Molecular Formula | C24H19N5O3 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | [(5S,7S)-5,7-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1c2ncnn2[C@H](c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H19N5O3/c30-23(19-11-13-20(14-12-19)29(31)32)27-21(17-7-3-1-4-8-17)15-22(18-9-5-2-6-10-18)28-24(27)25-16-26-28/h1-14,16,21-22H,15H2/t21-,22-/m0/s1 |
| InChIKey | KWYNUJKVCACJPF-VXKWHMMOSA-N |
| XLogP | 4.57 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|