C19H17N5O3 — CID 7338643
[(5S,7S)-5-methyl-7-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-nitrophenyl)methanone (PubChem CID 7338643) has the molecular formula C19H17N5O3 and a molecular weight of 363.38 g/mol. Its IUPAC name is [(5S,7S)-5-methyl-7-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-nitrophenyl)methanone.
| Compound Name | [(5S,7S)-5-methyl-7-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 7338643 |
| Molecular Formula | C19H17N5O3 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | [(5S,7S)-5-methyl-7-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-(3-nitrophenyl)methanone |
| SMILES | C[C@H]1C[C@@H](c2ccccc2)n2ncnc2N1C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17N5O3/c1-13-10-17(14-6-3-2-4-7-14)23-19(20-12-21-23)22(13)18(25)15-8-5-9-16(11-15)24(26)27/h2-9,11-13,17H,10H2,1H3/t13-,17-/m0/s1 |
| InChIKey | FTXCVXWZZDMWQI-GUYCJALGSA-N |
| XLogP | 3.21 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|