C14H12N2OS3 — CID 41340187
N-(6-methylsulfanyl-1,3-benzothiazol-2-yl)-2-thiophen-2-ylacetamide (PubChem CID 41340187) has the molecular formula C14H12N2OS3 and a molecular weight of 320.46 g/mol. Its IUPAC name is N-(6-methylsulfanyl-1,3-benzothiazol-2-yl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(6-methylsulfanyl-1,3-benzothiazol-2-yl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 41340187 |
| Molecular Formula | C14H12N2OS3 |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | N-(6-methylsulfanyl-1,3-benzothiazol-2-yl)-2-thiophen-2-ylacetamide |
| SMILES | CSc1ccc2nc(NC(=O)Cc3cccs3)sc2c1 |
| InChI | InChI=1S/C14H12N2OS3/c1-18-9-4-5-11-12(7-9)20-14(15-11)16-13(17)8-10-3-2-6-19-10/h2-7H,8H2,1H3,(H,15,16,17) |
| InChIKey | NIWPYMATLKIOPM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|