C15H12N2O3S2 — CID 2381090
[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-thiophen-2-ylacetate (PubChem CID 2381090) has the molecular formula C15H12N2O3S2 and a molecular weight of 332.41 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-thiophen-2-ylacetate.
| Compound Name | [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 2381090 |
| Molecular Formula | C15H12N2O3S2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-thiophen-2-ylacetate |
| SMILES | O=C(COC(=O)Cc1cccs1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H12N2O3S2/c18-13(9-20-14(19)8-10-4-3-7-21-10)17-15-16-11-5-1-2-6-12(11)22-15/h1-7H,8-9H2,(H,16,17,18) |
| InChIKey | NRNIDWDADLDYIR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |