C18H22N4O4S — CID 41342100
2-[5-(hydroxymethyl)-2-[2-(4-methoxyanilino)-2-oxoethyl]sulfanylimidazol-1-yl]-N-prop-2-enylacetamide (PubChem CID 41342100) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is 2-[5-(hydroxymethyl)-2-[2-(4-methoxyanilino)-2-oxoethyl]sulfanylimidazol-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[5-(hydroxymethyl)-2-[2-(4-methoxyanilino)-2-oxoethyl]sulfanylimidazol-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 41342100 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-[5-(hydroxymethyl)-2-[2-(4-methoxyanilino)-2-oxoethyl]sulfanylimidazol-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cn1c(CO)cnc1SCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H22N4O4S/c1-3-8-19-16(24)10-22-14(11-23)9-20-18(22)27-12-17(25)21-13-4-6-15(26-2)7-5-13/h3-7,9,23H,1,8,10-12H2,2H3,(H,19,24)(H,21,25) |
| InChIKey | GNHLXYIFZMXDSY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|