C19H24N4O5S — CID 41342103
2-[2-[2-(2,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-5-(hydroxymethyl)imidazol-1-yl]-N-prop-2-enylacetamide (PubChem CID 41342103) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is 2-[2-[2-(2,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-5-(hydroxymethyl)imidazol-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[2-[2-(2,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-5-(hydroxymethyl)imidazol-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 41342103 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-[2-[2-(2,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-5-(hydroxymethyl)imidazol-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cn1c(CO)cnc1SCC(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C19H24N4O5S/c1-4-7-20-17(25)10-23-13(11-24)9-21-19(23)29-12-18(26)22-15-6-5-14(27-2)8-16(15)28-3/h4-6,8-9,24H,1,7,10-12H2,2-3H3,(H,20,25)(H,22,26) |
| InChIKey | YAWXQYZFJMGYEJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|