C16H18ClN3O3S2 — CID 41343401
(2R)-1-(5-chlorothiophen-2-yl)sulfonyl-N-(6-methyl-2-pyridinyl)piperidine-2-carboxamide (PubChem CID 41343401) has the molecular formula C16H18ClN3O3S2 and a molecular weight of 399.93 g/mol. Its IUPAC name is (2R)-1-(5-chlorothiophen-2-yl)sulfonyl-N-(6-methyl-2-pyridinyl)piperidine-2-carboxamide.
| Compound Name | (2R)-1-(5-chlorothiophen-2-yl)sulfonyl-N-(6-methyl-2-pyridinyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 41343401 |
| Molecular Formula | C16H18ClN3O3S2 |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | (2R)-1-(5-chlorothiophen-2-yl)sulfonyl-N-(6-methyl-2-pyridinyl)piperidine-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)[C@H]2CCCCN2S(=O)(=O)c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C16H18ClN3O3S2/c1-11-5-4-7-14(18-11)19-16(21)12-6-2-3-10-20(12)25(22,23)15-9-8-13(17)24-15/h4-5,7-9,12H,2-3,6,10H2,1H3,(H,18,19,21)/t12-/m1/s1 |
| InChIKey | HDXRZBVZIFIIGU-GFCCVEGCSA-N |
| XLogP | 3.29 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |