C25H28N4O3S — CID 41345324
N-[2-(diethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(6-ethyl-1,3-benzothiazol-2-yl)acetamide (PubChem CID 41345324) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(6-ethyl-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(6-ethyl-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 41345324 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(6-ethyl-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CCc1ccc2nc(N(CCN(CC)CC)C(=O)CN3C(=O)c4ccccc4C3=O)sc2c1 |
| InChI | InChI=1S/C25H28N4O3S/c1-4-17-11-12-20-21(15-17)33-25(26-20)28(14-13-27(5-2)6-3)22(30)16-29-23(31)18-9-7-8-10-19(18)24(29)32/h7-12,15H,4-6,13-14,16H2,1-3H3 |
| InChIKey | YPIGJFXDUSKRTF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|